C20H14N3O4- — CID 6980203
2-[[4-(pyridin-2-ylcarbamoyl)phenyl]carbamoyl]benzoate (PubChem CID 6980203) has the molecular formula C20H14N3O4- and a molecular weight of 360.35 g/mol. Its IUPAC name is 2-[[4-(pyridin-2-ylcarbamoyl)phenyl]carbamoyl]benzoate.
| Compound Name | 2-[[4-(pyridin-2-ylcarbamoyl)phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 6980203 |
| Molecular Formula | C20H14N3O4- |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2-[[4-(pyridin-2-ylcarbamoyl)phenyl]carbamoyl]benzoate |
| SMILES | O=C(Nc1ccccn1)c1ccc(NC(=O)c2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C20H15N3O4/c24-18(23-17-7-3-4-12-21-17)13-8-10-14(11-9-13)22-19(25)15-5-1-2-6-16(15)20(26)27/h1-12H,(H,22,25)(H,26,27)(H,21,23,24)/p-1 |
| InChIKey | ZFZAWDNBOSWFQF-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |