About pyrazine;N-pyridin-2-ylbenzamide
pyrazine;N-pyridin-2-ylbenzamide (PubChem CID 158820949) has the molecular formula C16H14N4O
and a molecular weight of 278.31 g/mol. Its IUPAC name is pyrazine;N-pyridin-2-ylbenzamide.
Molecular Properties
| Compound Name | pyrazine;N-pyridin-2-ylbenzamide |
| PubChem CID | 158820949 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | pyrazine;N-pyridin-2-ylbenzamide |
| SMILES | O=C(Nc1ccccn1)c1ccccc1.c1cnccn1 |
| InChI | InChI=1S/C12H10N2O.C4H4N2/c15-12(10-6-2-1-3-7-10)14-11-8-4-5-9-13-11;1-2-6-4-3-5-1/h1-9H,(H,13,14,15);1-4H |
| InChIKey | IVWCMVVMPYUZKC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrazine;N-pyridin-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazine;N-pyridin-2-ylbenzamide?
The IUPAC name of pyrazine;N-pyridin-2-ylbenzamide (CID 158820949) is pyrazine;N-pyridin-2-ylbenzamide.
What is the SMILES notation for pyrazine;N-pyridin-2-ylbenzamide?
The canonical SMILES for pyrazine;N-pyridin-2-ylbenzamide is O=C(Nc1ccccn1)c1ccccc1.c1cnccn1.
What is the InChIKey of pyrazine;N-pyridin-2-ylbenzamide?
The InChIKey is IVWCMVVMPYUZKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O.C4H4N2/c15-12(10-6-2-1-3-7-10)14-11-8-4-5-9-13-11;1-2-6-4-3-5-1/h1-9H,(H,13,14,15);1-4H.
What are the key properties of pyrazine;N-pyridin-2-ylbenzamide?
pyrazine;N-pyridin-2-ylbenzamide has a molecular weight of 278.31 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazine;N-pyridin-2-ylbenzamide is sourced from PubChem (CID 158820949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).