About pyridine;N-pyridin-2-ylacetamide
pyridine;N-pyridin-2-ylacetamide (PubChem CID 67298573) has the molecular formula C12H13N3O
and a molecular weight of 215.26 g/mol. Its IUPAC name is pyridine;N-pyridin-2-ylacetamide.
Molecular Properties
| Compound Name | pyridine;N-pyridin-2-ylacetamide |
| PubChem CID | 67298573 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | pyridine;N-pyridin-2-ylacetamide |
| SMILES | CC(=O)Nc1ccccn1.c1ccncc1 |
| InChI | InChI=1S/C7H8N2O.C5H5N/c1-6(10)9-7-4-2-3-5-8-7;1-2-4-6-5-3-1/h2-5H,1H3,(H,8,9,10);1-5H |
| InChIKey | XQQNBSJTIWJGKK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridine;N-pyridin-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;N-pyridin-2-ylacetamide?
The IUPAC name of pyridine;N-pyridin-2-ylacetamide (CID 67298573) is pyridine;N-pyridin-2-ylacetamide.
What is the SMILES notation for pyridine;N-pyridin-2-ylacetamide?
The canonical SMILES for pyridine;N-pyridin-2-ylacetamide is CC(=O)Nc1ccccn1.c1ccncc1.
What is the InChIKey of pyridine;N-pyridin-2-ylacetamide?
The InChIKey is XQQNBSJTIWJGKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C5H5N/c1-6(10)9-7-4-2-3-5-8-7;1-2-4-6-5-3-1/h2-5H,1H3,(H,8,9,10);1-5H.
What are the key properties of pyridine;N-pyridin-2-ylacetamide?
pyridine;N-pyridin-2-ylacetamide has a molecular weight of 215.26 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;N-pyridin-2-ylacetamide is sourced from PubChem (CID 67298573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).