C20H25N3O5 — CID 139146011
nonanedioic acid;N-pyridin-2-ylpyridine-3-carboxamide (PubChem CID 139146011) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is nonanedioic acid;N-pyridin-2-ylpyridine-3-carboxamide.
| Compound Name | nonanedioic acid;N-pyridin-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 139146011 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | nonanedioic acid;N-pyridin-2-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cccnc1.O=C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C11H9N3O.C9H16O4/c15-11(9-4-3-6-12-8-9)14-10-5-1-2-7-13-10;10-8(11)6-4-2-1-3-5-7-9(12)13/h1-8H,(H,13,14,15);1-7H2,(H,10,11)(H,12,13) |
| InChIKey | IHJBDINCCDUOCE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|