C21H25NO2 — CID 13417263
(E)-10-phenyl-10-pyridin-3-yldec-9-enoic acid (PubChem CID 13417263) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (E)-10-phenyl-10-pyridin-3-yldec-9-enoic acid.
| Compound Name | (E)-10-phenyl-10-pyridin-3-yldec-9-enoic acid |
|---|---|
| PubChem CID | 13417263 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (E)-10-phenyl-10-pyridin-3-yldec-9-enoic acid |
| SMILES | O=C(O)CCCCCCC/C=C(\c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C21H25NO2/c23-21(24)15-9-4-2-1-3-8-14-20(18-11-6-5-7-12-18)19-13-10-16-22-17-19/h5-7,10-14,16-17H,1-4,8-9,15H2,(H,23,24)/b20-14+ |
| InChIKey | JUQQBSODJNVOJH-XSFVSMFZSA-N |
| XLogP | 5.33 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|