C18H20N2O — CID 13417329
(E)-7-phenyl-7-pyridin-3-ylhept-6-enamide (PubChem CID 13417329) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is (E)-7-phenyl-7-pyridin-3-ylhept-6-enamide.
| Compound Name | (E)-7-phenyl-7-pyridin-3-ylhept-6-enamide |
|---|---|
| PubChem CID | 13417329 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (E)-7-phenyl-7-pyridin-3-ylhept-6-enamide |
| SMILES | NC(=O)CCCC/C=C(\c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C18H20N2O/c19-18(21)12-6-2-5-11-17(15-8-3-1-4-9-15)16-10-7-13-20-14-16/h1,3-4,7-11,13-14H,2,5-6,12H2,(H2,19,21)/b17-11+ |
| InChIKey | XVSJQUJPICTLFV-GZTJUZNOSA-N |
| XLogP | 3.56 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|