C25H26N2OS — CID 13423327
O-[(E)-7-phenyl-7-pyridin-3-ylhept-6-enyl] N-phenylcarbamothioate (PubChem CID 13423327) has the molecular formula C25H26N2OS and a molecular weight of 402.56 g/mol. Its IUPAC name is O-[(E)-7-phenyl-7-pyridin-3-ylhept-6-enyl] N-phenylcarbamothioate.
| Compound Name | O-[(E)-7-phenyl-7-pyridin-3-ylhept-6-enyl] N-phenylcarbamothioate |
|---|---|
| PubChem CID | 13423327 |
| Molecular Formula | C25H26N2OS |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | O-[(E)-7-phenyl-7-pyridin-3-ylhept-6-enyl] N-phenylcarbamothioate |
| SMILES | S=C(Nc1ccccc1)OCCCCC/C=C(\c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C25H26N2OS/c29-25(27-23-15-7-4-8-16-23)28-19-10-2-1-9-17-24(21-12-5-3-6-13-21)22-14-11-18-26-20-22/h3-8,11-18,20H,1-2,9-10,19H2,(H,27,29)/b24-17+ |
| InChIKey | QYLLIOQOYGTDFP-JJIBRWJFSA-N |
| XLogP | 6.49 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|