C28H24N2O3 — CID 54065609
6-[4-(naphthalene-1-carbonylamino)phenyl]-6-pyridin-3-ylhex-5-enoic acid (PubChem CID 54065609) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is 6-[4-(naphthalene-1-carbonylamino)phenyl]-6-pyridin-3-ylhex-5-enoic acid.
| Compound Name | 6-[4-(naphthalene-1-carbonylamino)phenyl]-6-pyridin-3-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 54065609 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 6-[4-(naphthalene-1-carbonylamino)phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| SMILES | O=C(O)CCCC=C(c1ccc(NC(=O)c2cccc3ccccc23)cc1)c1cccnc1 |
| InChI | InChI=1S/C28H24N2O3/c31-27(32)13-4-3-10-24(22-9-6-18-29-19-22)21-14-16-23(17-15-21)30-28(33)26-12-5-8-20-7-1-2-11-25(20)26/h1-2,5-12,14-19H,3-4,13H2,(H,30,33)(H,31,32) |
| InChIKey | MCSPEKWSRTYVHV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|