C27H24N2O4S — CID 54239564
6-[3-(naphthalen-1-ylsulfonylamino)phenyl]-6-pyridin-3-ylhex-5-enoic acid (PubChem CID 54239564) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is 6-[3-(naphthalen-1-ylsulfonylamino)phenyl]-6-pyridin-3-ylhex-5-enoic acid.
| Compound Name | 6-[3-(naphthalen-1-ylsulfonylamino)phenyl]-6-pyridin-3-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 54239564 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 6-[3-(naphthalen-1-ylsulfonylamino)phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| SMILES | O=C(O)CCCC=C(c1cccnc1)c1cccc(NS(=O)(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C27H24N2O4S/c30-27(31)16-4-3-13-24(22-11-7-17-28-19-22)21-10-5-12-23(18-21)29-34(32,33)26-15-6-9-20-8-1-2-14-25(20)26/h1-2,5-15,17-19,29H,3-4,16H2,(H,30,31) |
| InChIKey | QPAPSPQTEGOBJW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|