C27H24N2O3 — CID 54468032
6-[3-[methyl(3-phenylprop-2-ynoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid (PubChem CID 54468032) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is 6-[3-[methyl(3-phenylprop-2-ynoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid.
| Compound Name | 6-[3-[methyl(3-phenylprop-2-ynoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 54468032 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 6-[3-[methyl(3-phenylprop-2-ynoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| SMILES | CN(C(=O)C#Cc1ccccc1)c1cccc(C(=CCCCC(=O)O)c2cccnc2)c1 |
| InChI | InChI=1S/C27H24N2O3/c1-29(26(30)17-16-21-9-3-2-4-10-21)24-13-7-11-22(19-24)25(14-5-6-15-27(31)32)23-12-8-18-28-20-23/h2-4,7-14,18-20H,5-6,15H2,1H3,(H,31,32) |
| InChIKey | XGIKIJYVLVWKNM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|