C24H29N5O2 — CID 173334434
6-[3-[(N'-cyanocarbamimidoyl)-(2,2-dimethylpropyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid (PubChem CID 173334434) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 6-[3-[(N'-cyanocarbamimidoyl)-(2,2-dimethylpropyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid.
| Compound Name | 6-[3-[(N'-cyanocarbamimidoyl)-(2,2-dimethylpropyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 173334434 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 6-[3-[(N'-cyanocarbamimidoyl)-(2,2-dimethylpropyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| SMILES | CC(C)(C)CN(/C(N)=N/C#N)c1cccc(C(=CCCCC(=O)O)c2cccnc2)c1 |
| InChI | InChI=1S/C24H29N5O2/c1-24(2,3)16-29(23(26)28-17-25)20-10-6-8-18(14-20)21(11-4-5-12-22(30)31)19-9-7-13-27-15-19/h6-11,13-15H,4-5,12,16H2,1-3H3,(H2,26,28)(H,30,31) |
| InChIKey | UALVRQVEGKIQOM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|