C22H29N5O4S — CID 67746099
6-[3-[2-methylpropyl-(N'-sulfamoylcarbamimidoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid (PubChem CID 67746099) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is 6-[3-[2-methylpropyl-(N'-sulfamoylcarbamimidoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid.
| Compound Name | 6-[3-[2-methylpropyl-(N'-sulfamoylcarbamimidoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 67746099 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 6-[3-[2-methylpropyl-(N'-sulfamoylcarbamimidoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| SMILES | CC(C)CN(C(N)=NS(N)(=O)=O)c1cccc(C(=CCCCC(=O)O)c2cccnc2)c1 |
| InChI | InChI=1S/C22H29N5O4S/c1-16(2)15-27(22(23)26-32(24,30)31)19-9-5-7-17(13-19)20(10-3-4-11-21(28)29)18-8-6-12-25-14-18/h5-10,12-14,16H,3-4,11,15H2,1-2H3,(H2,23,26)(H,28,29)(H2,24,30,31) |
| InChIKey | CCAOIBXWTKEDGH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 151.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|