C27H27ClN2O4 — CID 54529984
6-[3-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid (PubChem CID 54529984) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is 6-[3-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid.
| Compound Name | 6-[3-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 54529984 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 6-[3-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)Nc1cccc(C(=CCCCC(=O)O)c2cccnc2)c1 |
| InChI | InChI=1S/C27H27ClN2O4/c1-27(2,34-23-14-12-21(28)13-15-23)26(33)30-22-9-5-7-19(17-22)24(10-3-4-11-25(31)32)20-8-6-16-29-18-20/h5-10,12-18H,3-4,11H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | YVVHCPPAOPUVIH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|