C30H26N2O3 — CID 19099626
(Z)-6-[4-[(2-phenylbenzoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid (PubChem CID 19099626) has the molecular formula C30H26N2O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is (Z)-6-[4-[(2-phenylbenzoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid.
| Compound Name | (Z)-6-[4-[(2-phenylbenzoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 19099626 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (Z)-6-[4-[(2-phenylbenzoyl)amino]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C(/c1ccc(NC(=O)c2ccccc2-c2ccccc2)cc1)c1cccnc1 |
| InChI | InChI=1S/C30H26N2O3/c33-29(34)15-7-6-12-26(24-11-8-20-31-21-24)23-16-18-25(19-17-23)32-30(35)28-14-5-4-13-27(28)22-9-2-1-3-10-22/h1-5,8-14,16-21H,6-7,15H2,(H,32,35)(H,33,34)/b26-12- |
| InChIKey | IJJJXYJQESBHBK-ZRGSRPPYSA-N |
| XLogP | 6.69 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|