C25H35NO3Si — CID 10320222
(Z)-7-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-7-pyridin-3-ylhept-6-enoic acid (PubChem CID 10320222) has the molecular formula C25H35NO3Si and a molecular weight of 425.65 g/mol. Its IUPAC name is (Z)-7-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-7-pyridin-3-ylhept-6-enoic acid.
| Compound Name | (Z)-7-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-7-pyridin-3-ylhept-6-enoic acid |
|---|---|
| PubChem CID | 10320222 |
| Molecular Formula | C25H35NO3Si |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (Z)-7-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-7-pyridin-3-ylhept-6-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(/C(=C/CCCCC(=O)O)c2cccnc2)cc1 |
| InChI | InChI=1S/C25H35NO3Si/c1-25(2,3)30(4,5)29-19-20-13-15-21(16-14-20)23(22-10-9-17-26-18-22)11-7-6-8-12-24(27)28/h9-11,13-18H,6-8,12,19H2,1-5H3,(H,27,28)/b23-11- |
| InChIKey | NOGYDWWTVIVYSQ-KSEXSDGBSA-N |
| XLogP | 6.68 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|