C20H23NO2 — CID 13417291
(Z)-2,2-dimethyl-7-phenyl-7-pyridin-3-ylhept-6-enoic acid (PubChem CID 13417291) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (Z)-2,2-dimethyl-7-phenyl-7-pyridin-3-ylhept-6-enoic acid.
| Compound Name | (Z)-2,2-dimethyl-7-phenyl-7-pyridin-3-ylhept-6-enoic acid |
|---|---|
| PubChem CID | 13417291 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (Z)-2,2-dimethyl-7-phenyl-7-pyridin-3-ylhept-6-enoic acid |
| SMILES | CC(C)(CCC/C=C(/c1ccccc1)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C20H23NO2/c1-20(2,19(22)23)13-7-6-12-18(16-9-4-3-5-10-16)17-11-8-14-21-15-17/h3-5,8-12,14-15H,6-7,13H2,1-2H3,(H,22,23)/b18-12- |
| InChIKey | VORHMCUVEZJITN-PDGQHHTCSA-N |
| XLogP | 4.79 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|