About calcium;hydride;pyridine-3-carboxylic acid
calcium;hydride;pyridine-3-carboxylic acid (PubChem CID 173013176) has the molecular formula C6H7CaNO2
and a molecular weight of 165.21 g/mol. Its IUPAC name is calcium;hydride;pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | calcium;hydride;pyridine-3-carboxylic acid |
| PubChem CID | 173013176 |
| Molecular Formula | C6H7CaNO2 |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.01 |
| IUPAC Name | calcium;hydride;pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C6H5NO2.Ca.2H/c8-6(9)5-2-1-3-7-4-5;;;/h1-4H,(H,8,9);;;/q;+2;2*-1 |
| InChIKey | FEYXAKQIGVTXEB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze calcium;hydride;pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;pyridine-3-carboxylic acid?
The IUPAC name of calcium;hydride;pyridine-3-carboxylic acid (CID 173013176) is calcium;hydride;pyridine-3-carboxylic acid.
What is the SMILES notation for calcium;hydride;pyridine-3-carboxylic acid?
The canonical SMILES for calcium;hydride;pyridine-3-carboxylic acid is O=C(O)c1cccnc1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;pyridine-3-carboxylic acid?
The InChIKey is FEYXAKQIGVTXEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.Ca.2H/c8-6(9)5-2-1-3-7-4-5;;;/h1-4H,(H,8,9);;;/q;+2;2*-1.
What are the key properties of calcium;hydride;pyridine-3-carboxylic acid?
calcium;hydride;pyridine-3-carboxylic acid has a molecular weight of 165.21 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;pyridine-3-carboxylic acid is sourced from PubChem (CID 173013176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).