About 4-carbamoylbenzoic acid;pyridine-3-carboxamide
4-carbamoylbenzoic acid;pyridine-3-carboxamide (PubChem CID 70159642) has the molecular formula C14H13N3O4
and a molecular weight of 287.28 g/mol. Its IUPAC name is 4-carbamoylbenzoic acid;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 4-carbamoylbenzoic acid;pyridine-3-carboxamide |
| PubChem CID | 70159642 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 4-carbamoylbenzoic acid;pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(C(=O)O)cc1.NC(=O)c1cccnc1 |
| InChI | InChI=1S/C8H7NO3.C6H6N2O/c9-7(10)5-1-3-6(4-2-5)8(11)12;7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,9,10)(H,11,12);1-4H,(H2,7,9) |
| InChIKey | QQLVOVZOKQKAOL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-carbamoylbenzoic acid;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carbamoylbenzoic acid;pyridine-3-carboxamide?
The IUPAC name of 4-carbamoylbenzoic acid;pyridine-3-carboxamide (CID 70159642) is 4-carbamoylbenzoic acid;pyridine-3-carboxamide.
What is the SMILES notation for 4-carbamoylbenzoic acid;pyridine-3-carboxamide?
The canonical SMILES for 4-carbamoylbenzoic acid;pyridine-3-carboxamide is NC(=O)c1ccc(C(=O)O)cc1.NC(=O)c1cccnc1.
What is the InChIKey of 4-carbamoylbenzoic acid;pyridine-3-carboxamide?
The InChIKey is QQLVOVZOKQKAOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3.C6H6N2O/c9-7(10)5-1-3-6(4-2-5)8(11)12;7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,9,10)(H,11,12);1-4H,(H2,7,9).
What are the key properties of 4-carbamoylbenzoic acid;pyridine-3-carboxamide?
4-carbamoylbenzoic acid;pyridine-3-carboxamide has a molecular weight of 287.28 g/mol, XLogP of 0.66, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carbamoylbenzoic acid;pyridine-3-carboxamide is sourced from PubChem (CID 70159642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).