About methane;pyridine-3-carboxamide
methane;pyridine-3-carboxamide (PubChem CID 19390506) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is methane;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | methane;pyridine-3-carboxamide |
| PubChem CID | 19390506 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | methane;pyridine-3-carboxamide |
| SMILES | C.NC(=O)c1cccnc1 |
| InChI | InChI=1S/C6H6N2O.CH4/c7-6(9)5-2-1-3-8-4-5;/h1-4H,(H2,7,9);1H4 |
| InChIKey | CAYBXEDDBCCDOP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;pyridine-3-carboxamide?
The IUPAC name of methane;pyridine-3-carboxamide (CID 19390506) is methane;pyridine-3-carboxamide.
What is the SMILES notation for methane;pyridine-3-carboxamide?
The canonical SMILES for methane;pyridine-3-carboxamide is C.NC(=O)c1cccnc1.
What is the InChIKey of methane;pyridine-3-carboxamide?
The InChIKey is CAYBXEDDBCCDOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.CH4/c7-6(9)5-2-1-3-8-4-5;/h1-4H,(H2,7,9);1H4.
What are the key properties of methane;pyridine-3-carboxamide?
methane;pyridine-3-carboxamide has a molecular weight of 138.17 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;pyridine-3-carboxamide is sourced from PubChem (CID 19390506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).