About benzenesulfonic acid;pyridine-3-carboxamide
benzenesulfonic acid;pyridine-3-carboxamide (PubChem CID 157114692) has the molecular formula C12H12N2O4S
and a molecular weight of 280.31 g/mol. Its IUPAC name is benzenesulfonic acid;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | benzenesulfonic acid;pyridine-3-carboxamide |
| PubChem CID | 157114692 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | benzenesulfonic acid;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C6H6N2O.C6H6O3S/c7-6(9)5-2-1-3-8-4-5;7-10(8,9)6-4-2-1-3-5-6/h1-4H,(H2,7,9);1-5H,(H,7,8,9) |
| InChIKey | AHGHMTBQQJGWQD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonic acid;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonic acid;pyridine-3-carboxamide?
The IUPAC name of benzenesulfonic acid;pyridine-3-carboxamide (CID 157114692) is benzenesulfonic acid;pyridine-3-carboxamide.
What is the SMILES notation for benzenesulfonic acid;pyridine-3-carboxamide?
The canonical SMILES for benzenesulfonic acid;pyridine-3-carboxamide is NC(=O)c1cccnc1.O=S(=O)(O)c1ccccc1.
What is the InChIKey of benzenesulfonic acid;pyridine-3-carboxamide?
The InChIKey is AHGHMTBQQJGWQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C6H6O3S/c7-6(9)5-2-1-3-8-4-5;7-10(8,9)6-4-2-1-3-5-6/h1-4H,(H2,7,9);1-5H,(H,7,8,9).
What are the key properties of benzenesulfonic acid;pyridine-3-carboxamide?
benzenesulfonic acid;pyridine-3-carboxamide has a molecular weight of 280.31 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonic acid;pyridine-3-carboxamide is sourced from PubChem (CID 157114692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).