About ethyl benzoate;pyridine-3-carboxamide
ethyl benzoate;pyridine-3-carboxamide (PubChem CID 175250777) has the molecular formula C15H16N2O3
and a molecular weight of 272.30 g/mol. Its IUPAC name is ethyl benzoate;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | ethyl benzoate;pyridine-3-carboxamide |
| PubChem CID | 175250777 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | ethyl benzoate;pyridine-3-carboxamide |
| SMILES | CCOC(=O)c1ccccc1.NC(=O)c1cccnc1 |
| InChI | InChI=1S/C9H10O2.C6H6N2O/c1-2-11-9(10)8-6-4-3-5-7-8;7-6(9)5-2-1-3-8-4-5/h3-7H,2H2,1H3;1-4H,(H2,7,9) |
| InChIKey | KRDBCEBILUYGMF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl benzoate;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl benzoate;pyridine-3-carboxamide?
The IUPAC name of ethyl benzoate;pyridine-3-carboxamide (CID 175250777) is ethyl benzoate;pyridine-3-carboxamide.
What is the SMILES notation for ethyl benzoate;pyridine-3-carboxamide?
The canonical SMILES for ethyl benzoate;pyridine-3-carboxamide is CCOC(=O)c1ccccc1.NC(=O)c1cccnc1.
What is the InChIKey of ethyl benzoate;pyridine-3-carboxamide?
The InChIKey is KRDBCEBILUYGMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C6H6N2O/c1-2-11-9(10)8-6-4-3-5-7-8;7-6(9)5-2-1-3-8-4-5/h3-7H,2H2,1H3;1-4H,(H2,7,9).
What are the key properties of ethyl benzoate;pyridine-3-carboxamide?
ethyl benzoate;pyridine-3-carboxamide has a molecular weight of 272.30 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl benzoate;pyridine-3-carboxamide is sourced from PubChem (CID 175250777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).