About benzene;pyridine-3-carboxamide
benzene;pyridine-3-carboxamide (PubChem CID 66766032) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is benzene;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | benzene;pyridine-3-carboxamide |
| PubChem CID | 66766032 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | benzene;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.c1ccccc1 |
| InChI | InChI=1S/C6H6N2O.C6H6/c7-6(9)5-2-1-3-8-4-5;1-2-4-6-5-3-1/h1-4H,(H2,7,9);1-6H |
| InChIKey | ZPFBETGJRRNJGT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;pyridine-3-carboxamide?
The IUPAC name of benzene;pyridine-3-carboxamide (CID 66766032) is benzene;pyridine-3-carboxamide.
What is the SMILES notation for benzene;pyridine-3-carboxamide?
The canonical SMILES for benzene;pyridine-3-carboxamide is NC(=O)c1cccnc1.c1ccccc1.
What is the InChIKey of benzene;pyridine-3-carboxamide?
The InChIKey is ZPFBETGJRRNJGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C6H6/c7-6(9)5-2-1-3-8-4-5;1-2-4-6-5-3-1/h1-4H,(H2,7,9);1-6H.
What are the key properties of benzene;pyridine-3-carboxamide?
benzene;pyridine-3-carboxamide has a molecular weight of 200.24 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;pyridine-3-carboxamide is sourced from PubChem (CID 66766032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).