About 4-aminobenzoic acid;pyridine-3-carboxamide
4-aminobenzoic acid;pyridine-3-carboxamide (PubChem CID 23082444) has the molecular formula C13H13N3O3
and a molecular weight of 259.27 g/mol. Its IUPAC name is 4-aminobenzoic acid;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 4-aminobenzoic acid;pyridine-3-carboxamide |
| PubChem CID | 23082444 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-aminobenzoic acid;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C7H7NO2.C6H6N2O/c8-6-3-1-5(2-4-6)7(9)10;7-6(9)5-2-1-3-8-4-5/h1-4H,8H2,(H,9,10);1-4H,(H2,7,9) |
| InChIKey | PCQLPDJJIUQASF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzoic acid;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzoic acid;pyridine-3-carboxamide?
The IUPAC name of 4-aminobenzoic acid;pyridine-3-carboxamide (CID 23082444) is 4-aminobenzoic acid;pyridine-3-carboxamide.
What is the SMILES notation for 4-aminobenzoic acid;pyridine-3-carboxamide?
The canonical SMILES for 4-aminobenzoic acid;pyridine-3-carboxamide is NC(=O)c1cccnc1.Nc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-aminobenzoic acid;pyridine-3-carboxamide?
The InChIKey is PCQLPDJJIUQASF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C6H6N2O/c8-6-3-1-5(2-4-6)7(9)10;7-6(9)5-2-1-3-8-4-5/h1-4H,8H2,(H,9,10);1-4H,(H2,7,9).
What are the key properties of 4-aminobenzoic acid;pyridine-3-carboxamide?
4-aminobenzoic acid;pyridine-3-carboxamide has a molecular weight of 259.27 g/mol, XLogP of 1.15, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzoic acid;pyridine-3-carboxamide is sourced from PubChem (CID 23082444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).