About nickel;pyridine-3-carboxylic acid
nickel;pyridine-3-carboxylic acid (PubChem CID 174049937) has the molecular formula C6H5NNiO2
and a molecular weight of 181.80 g/mol. Its IUPAC name is nickel;pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | nickel;pyridine-3-carboxylic acid |
| PubChem CID | 174049937 |
| Molecular Formula | C6H5NNiO2 |
| Molecular Weight | 181.80 g/mol |
| Exact Mass | 180.97 |
| IUPAC Name | nickel;pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1.[Ni] |
| InChI | InChI=1S/C6H5NO2.Ni/c8-6(9)5-2-1-3-7-4-5;/h1-4H,(H,8,9); |
| InChIKey | PSLMFJWKWLEASI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.80 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze nickel;pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;pyridine-3-carboxylic acid?
The IUPAC name of nickel;pyridine-3-carboxylic acid (CID 174049937) is nickel;pyridine-3-carboxylic acid.
What is the SMILES notation for nickel;pyridine-3-carboxylic acid?
The canonical SMILES for nickel;pyridine-3-carboxylic acid is O=C(O)c1cccnc1.[Ni].
What is the InChIKey of nickel;pyridine-3-carboxylic acid?
The InChIKey is PSLMFJWKWLEASI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.Ni/c8-6(9)5-2-1-3-7-4-5;/h1-4H,(H,8,9);.
What are the key properties of nickel;pyridine-3-carboxylic acid?
nickel;pyridine-3-carboxylic acid has a molecular weight of 181.80 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;pyridine-3-carboxylic acid is sourced from PubChem (CID 174049937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).