About 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid
1-(dimethylamino)ethanol;pyridine-3-carboxylic acid (PubChem CID 23620885) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid |
| PubChem CID | 23620885 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid |
| SMILES | CC(O)N(C)C.O=C(O)c1cccnc1 |
| InChI | InChI=1S/C6H5NO2.C4H11NO/c8-6(9)5-2-1-3-7-4-5;1-4(6)5(2)3/h1-4H,(H,8,9);4,6H,1-3H3 |
| InChIKey | CKVLSNDQXAPMMI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid?
The IUPAC name of 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid (CID 23620885) is 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid.
What is the SMILES notation for 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid?
The canonical SMILES for 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid is CC(O)N(C)C.O=C(O)c1cccnc1.
What is the InChIKey of 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid?
The InChIKey is CKVLSNDQXAPMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C4H11NO/c8-6(9)5-2-1-3-7-4-5;1-4(6)5(2)3/h1-4H,(H,8,9);4,6H,1-3H3.
What are the key properties of 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid?
1-(dimethylamino)ethanol;pyridine-3-carboxylic acid has a molecular weight of 212.25 g/mol, XLogP of 0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethanol;pyridine-3-carboxylic acid is sourced from PubChem (CID 23620885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).