C12H18N2O4 — CID 159388080
(2S)-2-amino-4-methylpentanoic acid;pyridine-3-carboxylic acid (PubChem CID 159388080) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2S)-2-amino-4-methylpentanoic acid;pyridine-3-carboxylic acid.
| Compound Name | (2S)-2-amino-4-methylpentanoic acid;pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 159388080 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2S)-2-amino-4-methylpentanoic acid;pyridine-3-carboxylic acid |
| SMILES | CC(C)C[C@H](N)C(=O)O.O=C(O)c1cccnc1 |
| InChI | InChI=1S/C6H5NO2.C6H13NO2/c8-6(9)5-2-1-3-7-4-5;1-4(2)3-5(7)6(8)9/h1-4H,(H,8,9);4-5H,3,7H2,1-2H3,(H,8,9)/t;5-/m.0/s1 |
| InChIKey | LLTJUMASBXHVQE-ZSCHJXSPSA-N |
| XLogP | 1.22 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |