About 2-aminoacetic acid;bis(pyridine-3-carboxylic acid)
2-aminoacetic acid;bis(pyridine-3-carboxylic acid) (PubChem CID 146402763) has the molecular formula C14H15N3O6
and a molecular weight of 321.29 g/mol. Its IUPAC name is 2-aminoacetic acid;bis(pyridine-3-carboxylic acid).
Molecular Properties
| Compound Name | 2-aminoacetic acid;bis(pyridine-3-carboxylic acid) |
| PubChem CID | 146402763 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-aminoacetic acid;bis(pyridine-3-carboxylic acid) |
| SMILES | NCC(=O)O.O=C(O)c1cccnc1.O=C(O)c1cccnc1 |
| InChI | InChI=1S/2C6H5NO2.C2H5NO2/c2*8-6(9)5-2-1-3-7-4-5;3-1-2(4)5/h2*1-4H,(H,8,9);1,3H2,(H,4,5) |
| InChIKey | BARTXIVRZBPRCX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 163.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-aminoacetic acid;bis(pyridine-3-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;bis(pyridine-3-carboxylic acid)?
The IUPAC name of 2-aminoacetic acid;bis(pyridine-3-carboxylic acid) (CID 146402763) is 2-aminoacetic acid;bis(pyridine-3-carboxylic acid).
What is the SMILES notation for 2-aminoacetic acid;bis(pyridine-3-carboxylic acid)?
The canonical SMILES for 2-aminoacetic acid;bis(pyridine-3-carboxylic acid) is NCC(=O)O.O=C(O)c1cccnc1.O=C(O)c1cccnc1.
What is the InChIKey of 2-aminoacetic acid;bis(pyridine-3-carboxylic acid)?
The InChIKey is BARTXIVRZBPRCX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5NO2.C2H5NO2/c2*8-6(9)5-2-1-3-7-4-5;3-1-2(4)5/h2*1-4H,(H,8,9);1,3H2,(H,4,5).
What are the key properties of 2-aminoacetic acid;bis(pyridine-3-carboxylic acid)?
2-aminoacetic acid;bis(pyridine-3-carboxylic acid) has a molecular weight of 321.29 g/mol, XLogP of 0.59, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;bis(pyridine-3-carboxylic acid) is sourced from PubChem (CID 146402763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).