About 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride
2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride (PubChem CID 174889532) has the molecular formula C11H19ClN2O3
and a molecular weight of 262.74 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride.
Molecular Properties
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride |
| PubChem CID | 174889532 |
| Molecular Formula | C11H19ClN2O3 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride |
| SMILES | C[N+](C)(C)CCO.O=C(O)c1cccnc1.[Cl-] |
| InChI | InChI=1S/C6H5NO2.C5H14NO.ClH/c8-6(9)5-2-1-3-7-4-5;1-6(2,3)4-5-7;/h1-4H,(H,8,9);7H,4-5H2,1-3H3;1H/q;+1;/p-1 |
| InChIKey | AEMLTMDATRPBDV-UHFFFAOYSA-M |
| XLogP | -2.53 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride?
The IUPAC name of 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride (CID 174889532) is 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride.
What is the SMILES notation for 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride?
The canonical SMILES for 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride is C[N+](C)(C)CCO.O=C(O)c1cccnc1.[Cl-].
What is the InChIKey of 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride?
The InChIKey is AEMLTMDATRPBDV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO2.C5H14NO.ClH/c8-6(9)5-2-1-3-7-4-5;1-6(2,3)4-5-7;/h1-4H,(H,8,9);7H,4-5H2,1-3H3;1H/q;+1;/p-1.
What are the key properties of 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride?
2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride has a molecular weight of 262.74 g/mol, XLogP of -2.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl(trimethyl)azanium;pyridine-3-carboxylic acid;chloride is sourced from PubChem (CID 174889532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).