About 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid
1-ethoxypropan-2-ol;pyridine-3-carboxylic acid (PubChem CID 158241647) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid |
| PubChem CID | 158241647 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid |
| SMILES | CCOCC(C)O.O=C(O)c1cccnc1 |
| InChI | InChI=1S/C6H5NO2.C5H12O2/c8-6(9)5-2-1-3-7-4-5;1-3-7-4-5(2)6/h1-4H,(H,8,9);5-6H,3-4H2,1-2H3 |
| InChIKey | GFPNCALIPZNFHN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid?
The IUPAC name of 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid (CID 158241647) is 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid.
What is the SMILES notation for 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid?
The canonical SMILES for 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid is CCOCC(C)O.O=C(O)c1cccnc1.
What is the InChIKey of 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid?
The InChIKey is GFPNCALIPZNFHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C5H12O2/c8-6(9)5-2-1-3-7-4-5;1-3-7-4-5(2)6/h1-4H,(H,8,9);5-6H,3-4H2,1-2H3.
What are the key properties of 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid?
1-ethoxypropan-2-ol;pyridine-3-carboxylic acid has a molecular weight of 227.26 g/mol, XLogP of 1.18, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-ol;pyridine-3-carboxylic acid is sourced from PubChem (CID 158241647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).