About iodoethane;pyridine-3-carboxylic acid
iodoethane;pyridine-3-carboxylic acid (PubChem CID 158495952) has the molecular formula C8H10INO2
and a molecular weight of 279.08 g/mol. Its IUPAC name is iodoethane;pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | iodoethane;pyridine-3-carboxylic acid |
| PubChem CID | 158495952 |
| Molecular Formula | C8H10INO2 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | iodoethane;pyridine-3-carboxylic acid |
| SMILES | CCI.O=C(O)c1cccnc1 |
| InChI | InChI=1S/C6H5NO2.C2H5I/c8-6(9)5-2-1-3-7-4-5;1-2-3/h1-4H,(H,8,9);2H2,1H3 |
| InChIKey | HJHFWRZOMYUAIT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodoethane;pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodoethane;pyridine-3-carboxylic acid?
The IUPAC name of iodoethane;pyridine-3-carboxylic acid (CID 158495952) is iodoethane;pyridine-3-carboxylic acid.
What is the SMILES notation for iodoethane;pyridine-3-carboxylic acid?
The canonical SMILES for iodoethane;pyridine-3-carboxylic acid is CCI.O=C(O)c1cccnc1.
What is the InChIKey of iodoethane;pyridine-3-carboxylic acid?
The InChIKey is HJHFWRZOMYUAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C2H5I/c8-6(9)5-2-1-3-7-4-5;1-2-3/h1-4H,(H,8,9);2H2,1H3.
What are the key properties of iodoethane;pyridine-3-carboxylic acid?
iodoethane;pyridine-3-carboxylic acid has a molecular weight of 279.08 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodoethane;pyridine-3-carboxylic acid is sourced from PubChem (CID 158495952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).