About tris(nitric acid);pyridine-3-carboxylic acid
tris(nitric acid);pyridine-3-carboxylic acid (PubChem CID 71410042) has the molecular formula C6H8N4O11
and a molecular weight of 312.15 g/mol. Its IUPAC name is tris(nitric acid);pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | tris(nitric acid);pyridine-3-carboxylic acid |
| PubChem CID | 71410042 |
| Molecular Formula | C6H8N4O11 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | tris(nitric acid);pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1.O=[N+]([O-])O.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C6H5NO2.3HNO3/c8-6(9)5-2-1-3-7-4-5;3*2-1(3)4/h1-4H,(H,8,9);3*(H,2,3,4) |
| InChIKey | PTZHJIXHXPHJFD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 240.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tris(nitric acid);pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(nitric acid);pyridine-3-carboxylic acid?
The IUPAC name of tris(nitric acid);pyridine-3-carboxylic acid (CID 71410042) is tris(nitric acid);pyridine-3-carboxylic acid.
What is the SMILES notation for tris(nitric acid);pyridine-3-carboxylic acid?
The canonical SMILES for tris(nitric acid);pyridine-3-carboxylic acid is O=C(O)c1cccnc1.O=[N+]([O-])O.O=[N+]([O-])O.O=[N+]([O-])O.
What is the InChIKey of tris(nitric acid);pyridine-3-carboxylic acid?
The InChIKey is PTZHJIXHXPHJFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.3HNO3/c8-6(9)5-2-1-3-7-4-5;3*2-1(3)4/h1-4H,(H,8,9);3*(H,2,3,4).
What are the key properties of tris(nitric acid);pyridine-3-carboxylic acid?
tris(nitric acid);pyridine-3-carboxylic acid has a molecular weight of 312.15 g/mol, XLogP of -0.26, 1 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tris(nitric acid);pyridine-3-carboxylic acid is sourced from PubChem (CID 71410042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).