C8H12N2O3 — CID 174921681
N,N-dimethylpyridine-3-carboxamide;hydrogen peroxide (PubChem CID 174921681) has the molecular formula C8H12N2O3 and a molecular weight of 184.20 g/mol. Its IUPAC name is N,N-dimethylpyridine-3-carboxamide;hydrogen peroxide.
| Compound Name | N,N-dimethylpyridine-3-carboxamide;hydrogen peroxide |
|---|---|
| PubChem CID | 174921681 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N,N-dimethylpyridine-3-carboxamide;hydrogen peroxide |
| SMILES | CN(C)C(=O)c1cccnc1.OO |
| InChI | InChI=1S/C8H10N2O.H2O2/c1-10(2)8(11)7-4-3-5-9-6-7;1-2/h3-6H,1-2H3;1-2H |
| InChIKey | SUOCXEGKFBRVAI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|