C10H16N2O — CID 142562125
N,N-dimethylpyridine-3-carboxamide;ethane (PubChem CID 142562125) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N,N-dimethylpyridine-3-carboxamide;ethane.
| Compound Name | N,N-dimethylpyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 142562125 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N,N-dimethylpyridine-3-carboxamide;ethane |
| SMILES | CC.CN(C)C(=O)c1cccnc1 |
| InChI | InChI=1S/C8H10N2O.C2H6/c1-10(2)8(11)7-4-3-5-9-6-7;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | PMSZRQDMPQSBRH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |