About CID 22254315
CID 22254315 (PubChem CID 22254315) has the molecular formula C7H9BNO4
and a molecular weight of 181.96 g/mol.
Molecular Properties
| Compound Name | CID 22254315 |
| PubChem CID | 22254315 |
| Molecular Formula | C7H9BNO4 |
| Molecular Weight | 181.96 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | — |
| SMILES | COC(=O)c1cccnc1.O[B]O |
| InChI | InChI=1S/C7H7NO2.BH2O2/c1-10-7(9)6-3-2-4-8-5-6;2-1-3/h2-5H,1H3;2-3H |
| InChIKey | YREVZLQVEPOZSR-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.96 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22254315 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22254315?
The IUPAC name of CID 22254315 (CID 22254315) is not available.
What is the SMILES notation for CID 22254315?
The canonical SMILES for CID 22254315 is COC(=O)c1cccnc1.O[B]O.
What is the InChIKey of CID 22254315?
The InChIKey is YREVZLQVEPOZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.BH2O2/c1-10-7(9)6-3-2-4-8-5-6;2-1-3/h2-5H,1H3;2-3H.
What are the key properties of CID 22254315?
CID 22254315 has a molecular weight of 181.96 g/mol, XLogP of -0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22254315 is sourced from PubChem (CID 22254315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).