About (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride
(2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride (PubChem CID 171109487) has the molecular formula C14H12ClNO4
and a molecular weight of 293.71 g/mol. Its IUPAC name is (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride |
| PubChem CID | 171109487 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccccc1OC(=O)c1cccnc1.Cl |
| InChI | InChI=1S/C14H11NO4.ClH/c1-18-14(17)11-6-2-3-7-12(11)19-13(16)10-5-4-8-15-9-10;/h2-9H,1H3;1H |
| InChIKey | WAMIDVAXCQAFSR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride?
The IUPAC name of (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride (CID 171109487) is (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride.
What is the SMILES notation for (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride?
The canonical SMILES for (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride is COC(=O)c1ccccc1OC(=O)c1cccnc1.Cl.
What is the InChIKey of (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride?
The InChIKey is WAMIDVAXCQAFSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO4.ClH/c1-18-14(17)11-6-2-3-7-12(11)19-13(16)10-5-4-8-15-9-10;/h2-9H,1H3;1H.
What are the key properties of (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride?
(2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride has a molecular weight of 293.71 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxycarbonylphenyl) pyridine-3-carboxylate;hydrochloride is sourced from PubChem (CID 171109487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).