C28H20O8 — CID 139985700
bis(2-methoxycarbonylphenyl) naphthalene-2,7-dicarboxylate (PubChem CID 139985700) has the molecular formula C28H20O8 and a molecular weight of 484.46 g/mol. Its IUPAC name is bis(2-methoxycarbonylphenyl) naphthalene-2,7-dicarboxylate.
| Compound Name | bis(2-methoxycarbonylphenyl) naphthalene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 139985700 |
| Molecular Formula | C28H20O8 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | bis(2-methoxycarbonylphenyl) naphthalene-2,7-dicarboxylate |
| SMILES | COC(=O)c1ccccc1OC(=O)c1ccc2ccc(C(=O)Oc3ccccc3C(=O)OC)cc2c1 |
| InChI | InChI=1S/C28H20O8/c1-33-27(31)21-7-3-5-9-23(21)35-25(29)18-13-11-17-12-14-19(16-20(17)15-18)26(30)36-24-10-6-4-8-22(24)28(32)34-2/h3-16H,1-2H3 |
| InChIKey | BXPOLVRYLOZFMO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|