C19H19NO4 — CID 2895573
(2-hex-3-enoxycarbonylphenyl) pyridine-3-carboxylate (PubChem CID 2895573) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is (2-hex-3-enoxycarbonylphenyl) pyridine-3-carboxylate.
| Compound Name | (2-hex-3-enoxycarbonylphenyl) pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2895573 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2-hex-3-enoxycarbonylphenyl) pyridine-3-carboxylate |
| SMILES | CCC=CCCOC(=O)c1ccccc1OC(=O)c1cccnc1 |
| InChI | InChI=1S/C19H19NO4/c1-2-3-4-7-13-23-19(22)16-10-5-6-11-17(16)24-18(21)15-9-8-12-20-14-15/h3-6,8-12,14H,2,7,13H2,1H3 |
| InChIKey | AKOBYNNFWPATDJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|