About hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate
hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate (PubChem CID 156500319) has the molecular formula C22H24O4
and a molecular weight of 352.43 g/mol. Its IUPAC name is hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate.
Molecular Properties
| Compound Name | hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate |
| PubChem CID | 156500319 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate |
| SMILES | CCC=CCCOC(=O)c1ccccc1OC=C(OC)c1ccccc1 |
| InChI | InChI=1S/C22H24O4/c1-3-4-5-11-16-25-22(23)19-14-9-10-15-20(19)26-17-21(24-2)18-12-7-6-8-13-18/h4-10,12-15,17H,3,11,16H2,1-2H3 |
| InChIKey | CNOPRXTUFMRBGQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate?
The IUPAC name of hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate (CID 156500319) is hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate.
What is the SMILES notation for hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate?
The canonical SMILES for hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate is CCC=CCCOC(=O)c1ccccc1OC=C(OC)c1ccccc1.
What is the InChIKey of hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate?
The InChIKey is CNOPRXTUFMRBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O4/c1-3-4-5-11-16-25-22(23)19-14-9-10-15-20(19)26-17-21(24-2)18-12-7-6-8-13-18/h4-10,12-15,17H,3,11,16H2,1-2H3.
What are the key properties of hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate?
hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate has a molecular weight of 352.43 g/mol, XLogP of 5.22, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hex-3-enyl 2-(2-methoxy-2-phenylethenoxy)benzoate is sourced from PubChem (CID 156500319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).