About [(Z)-hex-3-enyl] 2-phenylacetate
[(Z)-hex-3-enyl] 2-phenylacetate (PubChem CID 5367698) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is [(Z)-hex-3-enyl] 2-phenylacetate.
Molecular Properties
| Compound Name | [(Z)-hex-3-enyl] 2-phenylacetate |
| PubChem CID | 5367698 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [(Z)-hex-3-enyl] 2-phenylacetate |
| SMILES | CC/C=C\CCOC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H18O2/c1-2-3-4-8-11-16-14(15)12-13-9-6-5-7-10-13/h3-7,9-10H,2,8,11-12H2,1H3/b4-3- |
| InChIKey | FJKFIIYSBXHBCT-ARJAWSKDSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-hex-3-enyl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-hex-3-enyl] 2-phenylacetate?
The IUPAC name of [(Z)-hex-3-enyl] 2-phenylacetate (CID 5367698) is [(Z)-hex-3-enyl] 2-phenylacetate.
What is the SMILES notation for [(Z)-hex-3-enyl] 2-phenylacetate?
The canonical SMILES for [(Z)-hex-3-enyl] 2-phenylacetate is CC/C=C\CCOC(=O)Cc1ccccc1.
What is the InChIKey of [(Z)-hex-3-enyl] 2-phenylacetate?
The InChIKey is FJKFIIYSBXHBCT-ARJAWSKDSA-N. The full InChI is InChI=1S/C14H18O2/c1-2-3-4-8-11-16-14(15)12-13-9-6-5-7-10-13/h3-7,9-10H,2,8,11-12H2,1H3/b4-3-.
What are the key properties of [(Z)-hex-3-enyl] 2-phenylacetate?
[(Z)-hex-3-enyl] 2-phenylacetate has a molecular weight of 218.30 g/mol, XLogP of 3.13, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-hex-3-enyl] 2-phenylacetate is sourced from PubChem (CID 5367698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).