About hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate
hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate (PubChem CID 20981452) has the molecular formula C24H29O4-
and a molecular weight of 381.49 g/mol. Its IUPAC name is hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate.
Molecular Properties
| Compound Name | hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate |
| PubChem CID | 20981452 |
| Molecular Formula | C24H29O4- |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate |
| SMILES | CCC=CCCOC(=O)CCc1ccccc1.O=C([O-])CCc1ccccc1 |
| InChI | InChI=1S/C15H20O2.C9H10O2/c1-2-3-4-8-13-17-15(16)12-11-14-9-6-5-7-10-14;10-9(11)7-6-8-4-2-1-3-5-8/h3-7,9-10H,2,8,11-13H2,1H3;1-5H,6-7H2,(H,10,11)/p-1 |
| InChIKey | QNCRRDAYBSKGKX-UHFFFAOYSA-M |
| XLogP | 3.89 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate?
The IUPAC name of hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate (CID 20981452) is hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate.
What is the SMILES notation for hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate?
The canonical SMILES for hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate is CCC=CCCOC(=O)CCc1ccccc1.O=C([O-])CCc1ccccc1.
What is the InChIKey of hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate?
The InChIKey is QNCRRDAYBSKGKX-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H20O2.C9H10O2/c1-2-3-4-8-13-17-15(16)12-11-14-9-6-5-7-10-14;10-9(11)7-6-8-4-2-1-3-5-8/h3-7,9-10H,2,8,11-13H2,1H3;1-5H,6-7H2,(H,10,11)/p-1.
What are the key properties of hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate?
hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate has a molecular weight of 381.49 g/mol, XLogP of 3.89, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hex-3-enyl 3-phenylpropanoate;3-phenylpropanoate is sourced from PubChem (CID 20981452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).