About ethyl 3-phenylpropanoate;propanal
ethyl 3-phenylpropanoate;propanal (PubChem CID 90891703) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is ethyl 3-phenylpropanoate;propanal.
Molecular Properties
| Compound Name | ethyl 3-phenylpropanoate;propanal |
| PubChem CID | 90891703 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | ethyl 3-phenylpropanoate;propanal |
| SMILES | CCC=O.CCOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C11H14O2.C3H6O/c1-2-13-11(12)9-8-10-6-4-3-5-7-10;1-2-3-4/h3-7H,2,8-9H2,1H3;3H,2H2,1H3 |
| InChIKey | JFOHNPMNIQUUDS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-phenylpropanoate;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-phenylpropanoate;propanal?
The IUPAC name of ethyl 3-phenylpropanoate;propanal (CID 90891703) is ethyl 3-phenylpropanoate;propanal.
What is the SMILES notation for ethyl 3-phenylpropanoate;propanal?
The canonical SMILES for ethyl 3-phenylpropanoate;propanal is CCC=O.CCOC(=O)CCc1ccccc1.
What is the InChIKey of ethyl 3-phenylpropanoate;propanal?
The InChIKey is JFOHNPMNIQUUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.C3H6O/c1-2-13-11(12)9-8-10-6-4-3-5-7-10;1-2-3-4/h3-7H,2,8-9H2,1H3;3H,2H2,1H3.
What are the key properties of ethyl 3-phenylpropanoate;propanal?
ethyl 3-phenylpropanoate;propanal has a molecular weight of 236.31 g/mol, XLogP of 2.78, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-phenylpropanoate;propanal is sourced from PubChem (CID 90891703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).