C24H23NO3 — CID 91744199
ethyl 3-[4-(N-(4-formylphenyl)anilino)phenyl]propanoate (PubChem CID 91744199) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is ethyl 3-[4-(N-(4-formylphenyl)anilino)phenyl]propanoate.
| Compound Name | ethyl 3-[4-(N-(4-formylphenyl)anilino)phenyl]propanoate |
|---|---|
| PubChem CID | 91744199 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | ethyl 3-[4-(N-(4-formylphenyl)anilino)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(N(c2ccccc2)c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C24H23NO3/c1-2-28-24(27)17-12-19-8-13-22(14-9-19)25(21-6-4-3-5-7-21)23-15-10-20(18-26)11-16-23/h3-11,13-16,18H,2,12,17H2,1H3 |
| InChIKey | IIKXWBQELBUBNX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|