C39H32N2O — CID 102447385
4-(4-methyl-N-[4-[4-(N-(4-methylphenyl)anilino)phenyl]phenyl]anilino)benzaldehyde (PubChem CID 102447385) has the molecular formula C39H32N2O and a molecular weight of 544.70 g/mol. Its IUPAC name is 4-(4-methyl-N-[4-[4-(N-(4-methylphenyl)anilino)phenyl]phenyl]anilino)benzaldehyde.
| Compound Name | 4-(4-methyl-N-[4-[4-(N-(4-methylphenyl)anilino)phenyl]phenyl]anilino)benzaldehyde |
|---|---|
| PubChem CID | 102447385 |
| Molecular Formula | C39H32N2O |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 4-(4-methyl-N-[4-[4-(N-(4-methylphenyl)anilino)phenyl]phenyl]anilino)benzaldehyde |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccc(C)cc4)c4ccc(C=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H32N2O/c1-29-8-18-35(19-9-29)40(34-6-4-3-5-7-34)38-24-14-32(15-25-38)33-16-26-39(27-17-33)41(36-20-10-30(2)11-21-36)37-22-12-31(28-42)13-23-37/h3-28H,1-2H3 |
| InChIKey | UIHUFKUNWGHELR-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|