C34H29N3O — CID 90065635
4-(N-[(E)-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methylideneamino]anilino)benzaldehyde (PubChem CID 90065635) has the molecular formula C34H29N3O and a molecular weight of 495.63 g/mol. Its IUPAC name is 4-(N-[(E)-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methylideneamino]anilino)benzaldehyde.
| Compound Name | 4-(N-[(E)-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methylideneamino]anilino)benzaldehyde |
|---|---|
| PubChem CID | 90065635 |
| Molecular Formula | C34H29N3O |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 4-(N-[(E)-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methylideneamino]anilino)benzaldehyde |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(/C=N/N(c3ccccc3)c3ccc(C=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H29N3O/c1-26-8-16-30(17-9-26)36(31-18-10-27(2)11-19-31)32-20-12-28(13-21-32)24-35-37(33-6-4-3-5-7-33)34-22-14-29(25-38)15-23-34/h3-25H,1-2H3/b35-24+ |
| InChIKey | XDHZDUMCXQYYCT-JWHWKPFMSA-N |
| XLogP | 8.76 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|