C23H23N3 — CID 59096400
4-[(diphenylhydrazinylidene)methyl]-N-ethenyl-N-ethylaniline (PubChem CID 59096400) has the molecular formula C23H23N3 and a molecular weight of 341.46 g/mol. Its IUPAC name is 4-[(diphenylhydrazinylidene)methyl]-N-ethenyl-N-ethylaniline.
| Compound Name | 4-[(diphenylhydrazinylidene)methyl]-N-ethenyl-N-ethylaniline |
|---|---|
| PubChem CID | 59096400 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-[(diphenylhydrazinylidene)methyl]-N-ethenyl-N-ethylaniline |
| SMILES | C=CN(CC)c1ccc(C=NN(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N3/c1-3-25(4-2)21-17-15-20(16-18-21)19-24-26(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h3,5-19H,1,4H2,2H3 |
| InChIKey | CQTRHJWGYUHMRG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|