C18H23N3 — CID 54333940
N,N-diethyl-4-[[methyl(phenyl)hydrazinylidene]methyl]aniline (PubChem CID 54333940) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is N,N-diethyl-4-[[methyl(phenyl)hydrazinylidene]methyl]aniline.
| Compound Name | N,N-diethyl-4-[[methyl(phenyl)hydrazinylidene]methyl]aniline |
|---|---|
| PubChem CID | 54333940 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N,N-diethyl-4-[[methyl(phenyl)hydrazinylidene]methyl]aniline |
| SMILES | CCN(CC)c1ccc(C=NN(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H23N3/c1-4-21(5-2)18-13-11-16(12-14-18)15-19-20(3)17-9-7-6-8-10-17/h6-15H,4-5H2,1-3H3 |
| InChIKey | TUCVSIRQWDGUHY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|