C19H22N4S — CID 73186987
N-[[4-(diethylamino)phenyl]methylideneamino]-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 73186987) has the molecular formula C19H22N4S and a molecular weight of 338.48 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 73186987 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CCN(CC)c1ccc(C=NN(C)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H22N4S/c1-4-23(5-2)16-12-10-15(11-13-16)14-20-22(3)19-21-17-8-6-7-9-18(17)24-19/h6-14H,4-5H2,1-3H3 |
| InChIKey | HMXMSCPWJLEHFE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|