C10H13N3S — CID 143176372
N'-(1,3-benzothiazol-2-yl)-N'-ethylmethanediamine (PubChem CID 143176372) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is N'-(1,3-benzothiazol-2-yl)-N'-ethylmethanediamine.
| Compound Name | N'-(1,3-benzothiazol-2-yl)-N'-ethylmethanediamine |
|---|---|
| PubChem CID | 143176372 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N'-(1,3-benzothiazol-2-yl)-N'-ethylmethanediamine |
| SMILES | CCN(CN)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H13N3S/c1-2-13(7-11)10-12-8-5-3-4-6-9(8)14-10/h3-6H,2,7,11H2,1H3 |
| InChIKey | DTUBNWHJKWWWFT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|