methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate

C12H14N2O2S — CID 62006139

IUPACmethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate
SMILESCCN(CC(=O)OC)c1nc2ccccc2s1
InChIInChI=1S/C12H14N2O2S/c1-3-14(8-11(15)16-2)12-13-9-6-4-5-7-10(9)17-12/h4-7H,3,8H2,1-2H3
InChIKeyDUFSOBVPAWINES-UHFFFAOYSA-N
MW250.32 g/mol
LogP2.30
Rot. Bonds4

About methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate

methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate (PubChem CID 62006139) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate
PubChem CID62006139
Molecular FormulaC12H14N2O2S
Molecular Weight250.32 g/mol
Exact Mass250.08
IUPAC Namemethyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate
SMILESCCN(CC(=O)OC)c1nc2ccccc2s1
InChIInChI=1S/C12H14N2O2S/c1-3-14(8-11(15)16-2)12-13-9-6-4-5-7-10(9)17-12/h4-7H,3,8H2,1-2H3
InChIKeyDUFSOBVPAWINES-UHFFFAOYSA-N
XLogP2.30
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.32
LogP ≤ 52.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate?
The IUPAC name of methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate (CID 62006139) is methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate.
What is the SMILES notation for methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate?
The canonical SMILES for methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate is CCN(CC(=O)OC)c1nc2ccccc2s1.
What is the InChIKey of methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate?
The InChIKey is DUFSOBVPAWINES-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2S/c1-3-14(8-11(15)16-2)12-13-9-6-4-5-7-10(9)17-12/h4-7H,3,8H2,1-2H3.
What are the key properties of methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate?
methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate has a molecular weight of 250.32 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate is sourced from PubChem (CID 62006139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).