C12H14N2O2S — CID 62006139
methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate (PubChem CID 62006139) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate.
| Compound Name | methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate |
|---|---|
| PubChem CID | 62006139 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | methyl 2-[1,3-benzothiazol-2-yl(ethyl)amino]acetate |
| SMILES | CCN(CC(=O)OC)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H14N2O2S/c1-3-14(8-11(15)16-2)12-13-9-6-4-5-7-10(9)17-12/h4-7H,3,8H2,1-2H3 |
| InChIKey | DUFSOBVPAWINES-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |