C13H16IN3OS — CID 122653049
1-(1,3-benzothiazol-2-yl)-1-iodo-3-pentylurea (PubChem CID 122653049) has the molecular formula C13H16IN3OS and a molecular weight of 389.26 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-1-iodo-3-pentylurea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-1-iodo-3-pentylurea |
|---|---|
| PubChem CID | 122653049 |
| Molecular Formula | C13H16IN3OS |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-1-iodo-3-pentylurea |
| SMILES | CCCCCNC(=O)N(I)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H16IN3OS/c1-2-3-6-9-15-12(18)17(14)13-16-10-7-4-5-8-11(10)19-13/h4-5,7-8H,2-3,6,9H2,1H3,(H,15,18) |
| InChIKey | ALUXQGYLVMWDDZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|